CAS 19355-03-4 is the registry number for 3-Hydroxy-4-nitropyridine 1-oxide, 90%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-nitro-1-oxidopyridin-1-ium-3-ol (CAS 19355-03-4) is a chemical compound with the molecular formula C5H4N2O4 and a molecular weight of 156.10 g/mol. IUPAC name: 4-nitro-1-oxidopyridin-1-ium-3-ol. InChIKey: NDYDYCFFKFQTPA-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O4 |
|---|---|
| Molecular weight | 156.10 g/mol |
| IUPAC name | 4-nitro-1-oxidopyridin-1-ium-3-ol |
| InChIKey | NDYDYCFFKFQTPA-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC(=C1[N+](=O)[O-])O)[O-] |
Computed by PubChem (NCBI)