CAS 1313802-19-5 is the registry number for N1-(3-Aminopropyl)butane-1,4-diamine-1,2,3,4-13C4, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Spermidine-(butyl-(13)C4) is a spermidine in which four carbon atoms have been replaced by the 13C isotope. It is a (13)C-modified compound and a spermidine.
Source: ChEBI
| Molecular formula | C7H19N3 |
|---|---|
| Molecular weight | 149.22 g/mol |
| IUPAC name | N'-(3-aminopropyl)(1,2,3,4-13C4)butane-1,4-diamine |
| InChIKey | ATHGHQPFGPMSJY-UIWMGSJQSA-N |
| SMILES | C(CN)CN[13CH2][13CH2][13CH2][13CH2]N |
Computed by PubChem (NCBI)