Products 2514812-10-1
CAS 2514812-10-1 appears in our catalog under these names: Spermidine–d6, N-(3-Aminopropyl-d6)-1,4-butanediamine, 99 atom % D, min 96% Chemical Purity, Spermidine-d6, Spermidine-d6, 96.07%. Offered by: GLPBio, CDN, TargetMol, MedChemExpress. Available pack sizes: 1mg, 0,01g, 10 mg, 5 mg, 1 mg.
N'-(3-amino-1,1,2,2,3,3-hexadeuteriopropyl)butane-1,4-diamine (CAS 2514812-10-1) is a chemical compound with the molecular formula C7H19N3 and a molecular weight of 151.28 g/mol. IUPAC name: N'-(3-amino-1,1,2,2,3,3-hexadeuteriopropyl)butane-1,4-diamine. InChIKey: ATHGHQPFGPMSJY-RCKJUGKUSA-N.
| Molecular formula | C7H19N3 |
|---|---|
| Molecular weight | 151.28 g/mol |
| IUPAC name | N'-(3-amino-1,1,2,2,3,3-hexadeuteriopropyl)butane-1,4-diamine |
| InChIKey | ATHGHQPFGPMSJY-RCKJUGKUSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)C([2H])([2H])NCCCCN |
Computed by PubChem (NCBI)