Products 13140-82-4
CAS 13140-82-4 appears in our catalog under these names: 1,1'-([1,1'-Biphenyl]-4,4'-diyl)diurea, >95.0%(HPLC)(T), 1，1'-([1，1'-Biphenyl]-4，4'-diyl)diurea, 95.0%. Offered by: TCI, Chemat. Available pack sizes: 1g, 5g.
[4-[4-(carbamoylamino)phenyl]phenyl]urea (CAS 13140-82-4) is a chemical compound with the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. IUPAC name: [4-[4-(carbamoylamino)phenyl]phenyl]urea. InChIKey: SRRLARSZJZCFJZ-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O2 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | [4-[4-(carbamoylamino)phenyl]phenyl]urea |
| InChIKey | SRRLARSZJZCFJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)NC(=O)N)NC(=O)N |
Computed by PubChem (NCBI)