CAS 1314243-72-5 appears in our catalog under these names: 9,9-Spirobifluoren-4-yl-diphenyl-phosphineoxide, 99%, 9,9'-Spirobi[fluoren]-4-yldiphenylphosphine oxide, 98%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(1,4-benzo-{2,1,3}-thiadiazole)) (m:n=95:5 mole ratio), 9,9'–Spirobi(fluoren)–4–yldiphenylphosphine oxide. Offered by: Lumtec, Chemat Brand, GLPBio. Available pack sizes: 1g, 2g, on request.
4-diphenylphosphoryl-9,9'-spirobi[fluorene] (CAS 1314243-72-5) is a chemical compound with the molecular formula C37H25OP and a molecular weight of 516.6 g/mol. IUPAC name: 4-diphenylphosphoryl-9,9'-spirobi[fluorene]. InChIKey: RVLMXDFBFTZCQI-UHFFFAOYSA-N.
| Molecular formula | C37H25OP |
|---|---|
| Molecular weight | 516.6 g/mol |
| IUPAC name | 4-diphenylphosphoryl-9,9'-spirobi[fluorene] |
| InChIKey | RVLMXDFBFTZCQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC4=C3C5=CC=CC=C5C46C7=CC=CC=C7C8=CC=CC=C68 |
Computed by PubChem (NCBI)