CAS 1346002-85-4 is the registry number for Diphenyl(spiro[fluorene-9,9'-xanthen]-2-yl)phosphine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Diphenyl(spiro[fluorene-9,9'-xanthene]-2-yl)phosphane (CAS 1346002-85-4) is a chemical compound with the molecular formula C37H25OP and a molecular weight of 516.6 g/mol. IUPAC name: diphenyl(spiro[fluorene-9,9'-xanthene]-2-yl)phosphane. InChIKey: QEAXCTTZOFUKEB-UHFFFAOYSA-N.
| Molecular formula | C37H25OP |
|---|---|
| Molecular weight | 516.6 g/mol |
| IUPAC name | diphenyl(spiro[fluorene-9,9'-xanthene]-2-yl)phosphane |
| InChIKey | QEAXCTTZOFUKEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC4=C(C=C3)C5=CC=CC=C5C46C7=CC=CC=C7OC8=CC=CC=C68 |
Computed by PubChem (NCBI)