Products 1314319-01-1

CAS 1314319-01-1 is the registry number for 1-tert-butyl 4-methyl 4-(chloromethyl)piperidine-1,4-dicarboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-methyl 4-(chloromethyl)piperidine-1,4-dicarboxylate (CAS 1314319-01-1) is a chemical compound with the molecular formula C13H22ClNO4 and a molecular weight of 291.77 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-(chloromethyl)piperidine-1,4-dicarboxylate. InChIKey: XZPUEKMFNKEXIB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22ClNO4
Molecular weight291.77 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl 4-(chloromethyl)piperidine-1,4-dicarboxylate
InChIKeyXZPUEKMFNKEXIB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)(CCl)C(=O)OC

Computed by PubChem (NCBI)