CAS 1427386-72-8 is the registry number for 3-tert-Butyl 6-methyl 3-azabicyclo[3.1.1]heptane-3,6-dicarboxylate hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-tert-butyl 6-O-methyl 3-azabicyclo[3.1.1]heptane-3,6-dicarboxylate;hydrochloride (CAS 1427386-72-8) is a chemical compound with the molecular formula C13H22ClNO4 and a molecular weight of 291.77 g/mol. IUPAC name: 3-O-tert-butyl 6-O-methyl 3-azabicyclo[3.1.1]heptane-3,6-dicarboxylate;hydrochloride. InChIKey: QGTMWMXAYKPRDG-UHFFFAOYSA-N.
| Molecular formula | C13H22ClNO4 |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | 3-O-tert-butyl 6-O-methyl 3-azabicyclo[3.1.1]heptane-3,6-dicarboxylate;hydrochloride |
| InChIKey | QGTMWMXAYKPRDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C1)C2C(=O)OC.Cl |
Computed by PubChem (NCBI)