Products 1314436-76-4
CAS 1314436-76-4 is the registry number for 2-((2-Hydroxy-3-(methacryloyloxy)propyl)dimethylammonio)acetate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 25g.
2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-dimethylazaniumyl]acetate (CAS 1314436-76-4) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-dimethylazaniumyl]acetate. InChIKey: SMPSCRIUOUOXAG-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 2-[[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]-dimethylazaniumyl]acetate |
| InChIKey | SMPSCRIUOUOXAG-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(C[N+](C)(C)CC(=O)[O-])O |
Computed by PubChem (NCBI)