Products 1314603-15-0
CAS 1314603-15-0 is the registry number for 2-(2-(3-nitrophenyl)vinyl)benzo(d)1,3-oxazin-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(E)-2-(3-nitrophenyl)ethenyl]-3,1-benzoxazin-4-one (CAS 1314603-15-0) is a chemical compound with the molecular formula C16H10N2O4 and a molecular weight of 294.26 g/mol. IUPAC name: 2-[(E)-2-(3-nitrophenyl)ethenyl]-3,1-benzoxazin-4-one. InChIKey: XBYFGHMONVRUBR-CMDGGOBGSA-N.
| Molecular formula | C16H10N2O4 |
|---|---|
| Molecular weight | 294.26 g/mol |
| IUPAC name | 2-[(E)-2-(3-nitrophenyl)ethenyl]-3,1-benzoxazin-4-one |
| InChIKey | XBYFGHMONVRUBR-CMDGGOBGSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC(=N2)/C=C/C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)