Products 92566-37-5

CAS 92566-37-5 is the registry number for 8-Nitro-2-phenylquinoline-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-nitro-2-phenylquinoline-4-carboxylic acid (CAS 92566-37-5) is a chemical compound with the molecular formula C16H10N2O4 and a molecular weight of 294.26 g/mol. IUPAC name: 8-nitro-2-phenylquinoline-4-carboxylic acid. InChIKey: ZPBCZAOGVIOUQA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10N2O4
Molecular weight294.26 g/mol
IUPAC name8-nitro-2-phenylquinoline-4-carboxylic acid
InChIKeyZPBCZAOGVIOUQA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=C(C=CC=C3[N+](=O)[O-])C(=C2)C(=O)O

Computed by PubChem (NCBI)