CAS 1314740-53-8 appears in our catalog under these names: 2–(3,4,5–trifluorophenyl)propan–2–amine hydrochloride, 2-(3,4,5-trifluorophenyl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(3,4,5-trifluorophenyl)propan-2-amine (CAS 1314740-53-8) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)propan-2-amine. InChIKey: JAQXYTGGZWVPDH-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)propan-2-amine |
| InChIKey | JAQXYTGGZWVPDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C(=C1)F)F)F)N |
Computed by PubChem (NCBI)