CAS 1314789-82-6 appears in our catalog under these names: 1-(4-Bromo-3-chlorophenyl)cyclopropane-1-carboxylic acid, 96%, 1-(4-bromo-3-chlorophenyl)cyclopropane-1-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
1-(4-bromo-3-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 1314789-82-6) is a chemical compound with the molecular formula C10H8BrClO2 and a molecular weight of 275.52 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: MBEGUOFFROFUDN-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClO2 |
|---|---|
| Molecular weight | 275.52 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | MBEGUOFFROFUDN-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)