CAS 1704169-28-7 is the registry number for (E)-Methyl 3-(4-bromo-3-chlorophenyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl (E)-3-(4-bromo-3-chlorophenyl)prop-2-enoate (CAS 1704169-28-7) is a chemical compound with the molecular formula C10H8BrClO2 and a molecular weight of 275.52 g/mol. IUPAC name: methyl (E)-3-(4-bromo-3-chlorophenyl)prop-2-enoate. InChIKey: FTQHVVJEYMOWQZ-HWKANZROSA-N.
| Molecular formula | C10H8BrClO2 |
|---|---|
| Molecular weight | 275.52 g/mol |
| IUPAC name | methyl (E)-3-(4-bromo-3-chlorophenyl)prop-2-enoate |
| InChIKey | FTQHVVJEYMOWQZ-HWKANZROSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)