CAS 1314796-65-0 appears in our catalog under these names: 1-(2,4-BIS(TRIFLUOROMETHYL)PHENYL)CYCLOPROPANE-1-CARBOXYLIC ACID, 95%, 1-[2,4-Bis(trifluoromethyl)phenyl]cyclopropanecarboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1-[2,4-bis(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 1314796-65-0) is a chemical compound with the molecular formula C12H8F6O2 and a molecular weight of 298.18 g/mol. IUPAC name: 1-[2,4-bis(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: SMNAVVZAQQUJDJ-UHFFFAOYSA-N.
| Molecular formula | C12H8F6O2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | 1-[2,4-bis(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | SMNAVVZAQQUJDJ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)