Products 705250-77-7

CAS 705250-77-7 is the registry number for 3,5-Bis(trifluoromethyl)cinnamic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoate (CAS 705250-77-7) is a chemical compound with the molecular formula C12H8F6O2 and a molecular weight of 298.18 g/mol. IUPAC name: methyl (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoate. InChIKey: MRGWQPMEUHGQRY-NSCUHMNNSA-N.

Identity
Molecular formulaC12H8F6O2
Molecular weight298.18 g/mol
IUPAC namemethyl (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoate
InChIKeyMRGWQPMEUHGQRY-NSCUHMNNSA-N
SMILESCOC(=O)/C=C/C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)