CAS 705250-77-7 is the registry number for 3,5-Bis(trifluoromethyl)cinnamic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoate (CAS 705250-77-7) is a chemical compound with the molecular formula C12H8F6O2 and a molecular weight of 298.18 g/mol. IUPAC name: methyl (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoate. InChIKey: MRGWQPMEUHGQRY-NSCUHMNNSA-N.
| Molecular formula | C12H8F6O2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | methyl (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoate |
| InChIKey | MRGWQPMEUHGQRY-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)