Products 1314900-53-2

CAS 1314900-53-2 appears in our catalog under these names: 2-Amino-3,4-dimethylpentanoic acid, 2-Amino-3,4-dimethylpentanoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

2-amino-3,4-dimethylpentanoic acid (CAS 1314900-53-2) is a chemical compound with the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. IUPAC name: 2-amino-3,4-dimethylpentanoic acid. InChIKey: VFEDCKXLINRKLV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15NO2
Molecular weight145.20 g/mol
IUPAC name2-amino-3,4-dimethylpentanoic acid
InChIKeyVFEDCKXLINRKLV-UHFFFAOYSA-N
SMILESCC(C)C(C)C(C(=O)O)N

Computed by PubChem (NCBI)