CAS 23262-01-3 is the registry number for (2S,3S)-2-Amino-3,4-dimethylpentanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2-amino-3,4-dimethylpentanoic acid (CAS 23262-01-3) is a chemical compound with the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. IUPAC name: (2S,3S)-2-amino-3,4-dimethylpentanoic acid. InChIKey: VFEDCKXLINRKLV-WDSKDSINSA-N.
| Molecular formula | C7H15NO2 |
|---|---|
| Molecular weight | 145.20 g/mol |
| IUPAC name | (2S,3S)-2-amino-3,4-dimethylpentanoic acid |
| InChIKey | VFEDCKXLINRKLV-WDSKDSINSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)C(C)C |
Computed by PubChem (NCBI)