CAS 1314906-78-9 is the registry number for 2,2-Difluoro-4,4-dimethylcyclohexane-1,3-dione hydrate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-4,4-dimethylcyclohexane-1,3-dione;hydrate (CAS 1314906-78-9) is a chemical compound with the molecular formula C8H12F2O3 and a molecular weight of 194.18 g/mol. IUPAC name: 2,2-difluoro-4,4-dimethylcyclohexane-1,3-dione;hydrate. InChIKey: OEZIKTWGHKZHSU-UHFFFAOYSA-N.
| Molecular formula | C8H12F2O3 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2,2-difluoro-4,4-dimethylcyclohexane-1,3-dione;hydrate |
| InChIKey | OEZIKTWGHKZHSU-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)C(C1=O)(F)F)C.O |
Computed by PubChem (NCBI)