Products 206346-77-2

CAS 206346-77-2 appears in our catalog under these names: 2,2-Difluoro-2-(1-hydroxycyclohexyl)acetic acid, 2,2-Difluoro-2-(1-hydroxycyclohexyl)acetic acid, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 250mg.

2,2-difluoro-2-(1-hydroxycyclohexyl)acetic acid (CAS 206346-77-2) is a chemical compound with the molecular formula C8H12F2O3 and a molecular weight of 194.18 g/mol. IUPAC name: 2,2-difluoro-2-(1-hydroxycyclohexyl)acetic acid. InChIKey: CJCOBYDZAQJLGO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F2O3
Molecular weight194.18 g/mol
IUPAC name2,2-difluoro-2-(1-hydroxycyclohexyl)acetic acid
InChIKeyCJCOBYDZAQJLGO-UHFFFAOYSA-N
SMILESC1CCC(CC1)(C(C(=O)O)(F)F)O

Computed by PubChem (NCBI)