CAS 1314959-58-4 is the registry number for 2-Amino-5-chloronicotinohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-5-chloropyridine-3-carbohydrazide (CAS 1314959-58-4) is a chemical compound with the molecular formula C6H7ClN4O and a molecular weight of 186.60 g/mol. IUPAC name: 2-amino-5-chloropyridine-3-carbohydrazide. InChIKey: KBUJHWYHHZWWDK-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN4O |
|---|---|
| Molecular weight | 186.60 g/mol |
| IUPAC name | 2-amino-5-chloropyridine-3-carbohydrazide |
| InChIKey | KBUJHWYHHZWWDK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)NN)N)Cl |
Computed by PubChem (NCBI)