CAS 71222-44-1 appears in our catalog under these names: 4,7-Dihydroimidazo[4,5-d][1,3]diazepin-8(1h)-one hydrochloride, 95%, 4,7-DIHYDRO-IMIDAZOLE[4,5-D]1,3-DIAZEPINE-8(1H)-ONE HCL, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 50mg.
4,7-dihydro-1H-imidazo[4,5-d][1,3]diazepin-8-one;hydrochloride (CAS 71222-44-1) is a chemical compound with the molecular formula C6H7ClN4O and a molecular weight of 186.60 g/mol. IUPAC name: 4,7-dihydro-1H-imidazo[4,5-d][1,3]diazepin-8-one;hydrochloride. InChIKey: IOUSBGFCJXEEEL-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN4O |
|---|---|
| Molecular weight | 186.60 g/mol |
| IUPAC name | 4,7-dihydro-1H-imidazo[4,5-d][1,3]diazepin-8-one;hydrochloride |
| InChIKey | IOUSBGFCJXEEEL-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(NC=N1)N=CN2.Cl |
Computed by PubChem (NCBI)