Products 1314987-27-3
CAS 1314987-27-3 is the registry number for Methyl 3-(dimethylamino)-4-formamidobenzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Methyl 3-(dimethylamino)-4-formamidobenzoate (CAS 1314987-27-3) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: methyl 3-(dimethylamino)-4-formamidobenzoate. InChIKey: RDJBWNFNJZBHQJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | methyl 3-(dimethylamino)-4-formamidobenzoate |
| InChIKey | RDJBWNFNJZBHQJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC(=C1)C(=O)OC)NC=O |
Computed by PubChem (NCBI)