CAS 1314987-28-4 is the registry number for 4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-bromo-5-fluoro-2-nitro-N-propan-2-ylaniline (CAS 1314987-28-4) is a chemical compound with the molecular formula C9H10BrFN2O2 and a molecular weight of 277.09 g/mol. IUPAC name: 4-bromo-5-fluoro-2-nitro-N-propan-2-ylaniline. InChIKey: BPXMIORTUXUUGS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFN2O2 |
|---|---|
| Molecular weight | 277.09 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-nitro-N-propan-2-ylaniline |
| InChIKey | BPXMIORTUXUUGS-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC(=C(C=C1[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)