CAS 1876283-04-3 is the registry number for 2-Amino-4-bromo-5-fluoro-n-methoxy-n-methyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-4-bromo-5-fluoro-N-methoxy-N-methylbenzamide (CAS 1876283-04-3) is a chemical compound with the molecular formula C9H10BrFN2O2 and a molecular weight of 277.09 g/mol. IUPAC name: 2-amino-4-bromo-5-fluoro-N-methoxy-N-methylbenzamide. InChIKey: IOGDZSZQAIDSRB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFN2O2 |
|---|---|
| Molecular weight | 277.09 g/mol |
| IUPAC name | 2-amino-4-bromo-5-fluoro-N-methoxy-N-methylbenzamide |
| InChIKey | IOGDZSZQAIDSRB-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(C=C1N)Br)F)OC |
Computed by PubChem (NCBI)