Products 131523-97-2
CAS 131523-97-2 is the registry number for (E)-3-Hydroxy Doxepin. Offered by: TRC. Available pack sizes: 100mg.
(11E)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-3-ol (CAS 131523-97-2) is a chemical compound with the molecular formula C19H21NO2 and a molecular weight of 295.4 g/mol. IUPAC name: (11E)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-3-ol. InChIKey: OHKQNFCWNWKAIY-CAOOACKPSA-N.
| Molecular formula | C19H21NO2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (11E)-11-[3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-3-ol |
| InChIKey | OHKQNFCWNWKAIY-CAOOACKPSA-N |
| SMILES | CN(C)CC/C=C\1/C2=C(C=C(C=C2)O)OCC3=CC=CC=C31 |
Computed by PubChem (NCBI)