CAS 1315281-51-6 appears in our catalog under these names: 4-(9-Carbazolylmethyl)benzeneboronic acid pinacol ester, 98%, 9-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)-9H-carbazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbazole (CAS 1315281-51-6) is a chemical compound with the molecular formula C25H26BNO2 and a molecular weight of 383.3 g/mol. IUPAC name: 9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbazole. InChIKey: AKZHQKVQCWCVBW-UHFFFAOYSA-N.
| Molecular formula | C25H26BNO2 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | 9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbazole |
| InChIKey | AKZHQKVQCWCVBW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3C4=CC=CC=C4C5=CC=CC=C53 |
Computed by PubChem (NCBI)