CAS 1357387-29-1 is the registry number for 9-Benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (CAS 1357387-29-1) is a chemical compound with the molecular formula C25H26BNO2 and a molecular weight of 383.3 g/mol. IUPAC name: 9-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole. InChIKey: UMWJZMUSYJMTOI-UHFFFAOYSA-N.
| Molecular formula | C25H26BNO2 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | 9-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| InChIKey | UMWJZMUSYJMTOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C4=CC=CC=C43)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)