Products 1315351-37-1
CAS 1315351-37-1 appears in our catalog under these names: 3-Bromo-2-chloropyridine-4-boronic acid pinacol ester, ≥95%, ≥95%, 3-Bromo-2-chloropyridine-4-boronic acid pinacol ester. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
3-bromo-2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1315351-37-1) is a chemical compound with the molecular formula C11H14BBrClNO2 and a molecular weight of 318.40 g/mol. IUPAC name: 3-bromo-2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QQJUXZLEAZFHEU-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrClNO2 |
|---|---|
| Molecular weight | 318.40 g/mol |
| IUPAC name | 3-bromo-2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QQJUXZLEAZFHEU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)Cl)Br |
Computed by PubChem (NCBI)