CAS 2121514-13-2 appears in our catalog under these names: 5-Bromo-4-chloropyridine-3-boronic acid pinacol ester, 95%, 3-Bromo-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 5-Bromo-4-chloropyridine-3-boronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
3-bromo-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121514-13-2) is a chemical compound with the molecular formula C11H14BBrClNO2 and a molecular weight of 318.40 g/mol. IUPAC name: 3-bromo-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: NQQSLHQVINHYBQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrClNO2 |
|---|---|
| Molecular weight | 318.40 g/mol |
| IUPAC name | 3-bromo-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | NQQSLHQVINHYBQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=C2Cl)Br |
Computed by PubChem (NCBI)