CAS 1315366-33-6 appears in our catalog under these names: 4,7-Dichloroquinoline-8-sulfonyl chloride, 95%, 4,7-Dichloroquinoline-8-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4,7-dichloroquinoline-8-sulfonyl chloride (CAS 1315366-33-6) is a chemical compound with the molecular formula C9H4Cl3NO2S and a molecular weight of 296.6 g/mol. IUPAC name: 4,7-dichloroquinoline-8-sulfonyl chloride. InChIKey: POGIMPXCNBVRSI-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3NO2S |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 4,7-dichloroquinoline-8-sulfonyl chloride |
| InChIKey | POGIMPXCNBVRSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=CC(=C21)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)