CAS 930396-15-9 is the registry number for 1,3-dichloroisoquinoline-7-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1,3-dichloroisoquinoline-7-sulfonyl chloride (CAS 930396-15-9) is a chemical compound with the molecular formula C9H4Cl3NO2S and a molecular weight of 296.6 g/mol. IUPAC name: 1,3-dichloroisoquinoline-7-sulfonyl chloride. InChIKey: ITORBCGERYBPLT-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3NO2S |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 1,3-dichloroisoquinoline-7-sulfonyl chloride |
| InChIKey | ITORBCGERYBPLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(N=C(C=C21)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)