Products 1315367-41-9
CAS 1315367-41-9 is the registry number for 3-Bromo-1-(1-methyl-1H-pyrazol-3-yl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one (CAS 1315367-41-9) is a chemical compound with the molecular formula C8H10BrN3O and a molecular weight of 244.09 g/mol. IUPAC name: 3-bromo-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one. InChIKey: DXBAKQQTSMCBCA-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3O |
|---|---|
| Molecular weight | 244.09 g/mol |
| IUPAC name | 3-bromo-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one |
| InChIKey | DXBAKQQTSMCBCA-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)N2CCC(C2=O)Br |
Computed by PubChem (NCBI)