Products 1315368-42-3
CAS 1315368-42-3 appears in our catalog under these names: 7-Amino-1,2,3,4-tetrahydroisoquinolin-1-one hydrochloride, 95%, 1(2H)-Isoquinolinone, 7-amino-3,4-dihydro-, 95%, 7-Amino-1,2,3,4-tetrahydroisoquinolin-1-one hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
7-amino-3,4-dihydro-2H-isoquinolin-1-one;hydrochloride (CAS 1315368-42-3) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 7-amino-3,4-dihydro-2H-isoquinolin-1-one;hydrochloride. InChIKey: IMMVVYYLKFAGLH-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 7-amino-3,4-dihydro-2H-isoquinolin-1-one;hydrochloride |
| InChIKey | IMMVVYYLKFAGLH-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)