CAS 1315368-48-9 appears in our catalog under these names: 6-Imino-5-methyl-1,6-dihydropyridine-3-sulfonyl chloride, 95%, 6-Amino-5-methylpyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-amino-5-methylpyridine-3-sulfonyl chloride (CAS 1315368-48-9) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 6-amino-5-methylpyridine-3-sulfonyl chloride. InChIKey: CUIVWFNEGLNRCW-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 6-amino-5-methylpyridine-3-sulfonyl chloride |
| InChIKey | CUIVWFNEGLNRCW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)