CAS 13154-27-3 appears in our catalog under these names: 2-Nitrocycloheptan-1-one, 95%, 2-Nitrocycloheptan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 1000mg.
2-nitrocycloheptan-1-one (CAS 13154-27-3) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: 2-nitrocycloheptan-1-one. InChIKey: UHRUAPNWENGYTC-UHFFFAOYSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 2-nitrocycloheptan-1-one |
| InChIKey | UHRUAPNWENGYTC-UHFFFAOYSA-N |
| SMILES | C1CCC(C(=O)CC1)[N+](=O)[O-] |
Computed by PubChem (NCBI)