CAS 1315552-06-7 is the registry number for Loline Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,7S,8R)-8-azido-2-oxa-6-azatricyclo[4.2.1.03,7]nonane (CAS 1315552-06-7) is a chemical compound with the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. IUPAC name: (1R,7S,8R)-8-azido-2-oxa-6-azatricyclo[4.2.1.03,7]nonane. InChIKey: DBHRKAFVWRKTKR-HDLDFLEYSA-N.
| Molecular formula | C7H10N4O |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (1R,7S,8R)-8-azido-2-oxa-6-azatricyclo[4.2.1.03,7]nonane |
| InChIKey | DBHRKAFVWRKTKR-HDLDFLEYSA-N |
| SMILES | C1CN2C[C@@H]3[C@@H]([C@H]2C1O3)N=[N+]=[N-] |
Computed by PubChem (NCBI)