CAS 1315552-07-8 appears in our catalog under these names: N-Boc temuline, N-((2R,3R,3aS,4S,6aS)-hexahydro-2,4-methano-4H-furo(3,2-b)pyrrol-3-yl)carbamic Acid 1,1-Dimethylethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
Tert-butyl N-[(1R,3S,7S,8R)-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-yl]carbamate (CAS 1315552-07-8) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl N-[(1R,3S,7S,8R)-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-yl]carbamate. InChIKey: IRRPQUWTLLNODP-QCLAVDOMSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S,7S,8R)-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-yl]carbamate |
| InChIKey | IRRPQUWTLLNODP-QCLAVDOMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@H]2CN3[C@@H]1[C@@H](O2)CC3 |
Computed by PubChem (NCBI)