Products 1315565-59-3

CAS 1315565-59-3 is the registry number for (4-(Fluoranthen-3-yl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(4-fluoranthen-3-ylphenyl)boronic acid (CAS 1315565-59-3) is a chemical compound with the molecular formula C22H15BO2 and a molecular weight of 322.2 g/mol. IUPAC name: (4-fluoranthen-3-ylphenyl)boronic acid. InChIKey: MVKWBPPVJXDTKO-UHFFFAOYSA-N.

Identity
Molecular formulaC22H15BO2
Molecular weight322.2 g/mol
IUPAC name(4-fluoranthen-3-ylphenyl)boronic acid
InChIKeyMVKWBPPVJXDTKO-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=C3C=CC=C4C3=C(C=C2)C5=CC=CC=C54)(O)O

Computed by PubChem (NCBI)