CAS 872050-52-7 appears in our catalog under these names: (4-(Pyren-1-yl)phenyl)boronic acid, 95%, 4–(1–Pyrenyl)phenylboronic Acid, 4-(1-Pyrenyl)phenylboronic Acid (contains varying amounts of Anhydride), (4-(Pyren-1-yl)phenyl)boronic acid 98%, (4-(Pyren-1-yl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(4-pyren-1-ylphenyl)boronic acid (CAS 872050-52-7) is a chemical compound with the molecular formula C22H15BO2 and a molecular weight of 322.2 g/mol. IUPAC name: (4-pyren-1-ylphenyl)boronic acid. InChIKey: ISMRPUXCQLIMJL-UHFFFAOYSA-N.
| Molecular formula | C22H15BO2 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | (4-pyren-1-ylphenyl)boronic acid |
| InChIKey | ISMRPUXCQLIMJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2)(O)O |
Computed by PubChem (NCBI)