CAS 1315590-91-0 appears in our catalog under these names: ((2S,4R)-4-Methoxypyrrolidin-2-yl)methanol hydrochloride, 98%, [(2S,4R)-4-methoxypyrrolidin-2-yl]methanol hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg.
[(2S,4R)-4-methoxypyrrolidin-2-yl]methanol;hydrochloride (CAS 1315590-91-0) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: [(2S,4R)-4-methoxypyrrolidin-2-yl]methanol;hydrochloride. InChIKey: JZJNYGFWGCTQFQ-RIHPBJNCSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | [(2S,4R)-4-methoxypyrrolidin-2-yl]methanol;hydrochloride |
| InChIKey | JZJNYGFWGCTQFQ-RIHPBJNCSA-N |
| SMILES | CO[C@@H]1C[C@H](NC1)CO.Cl |
Computed by PubChem (NCBI)