CAS 1610033-20-9 is the registry number for ((2R,4R)-4-Methoxypyrrolidin-2-yl)methanol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
[(2R,4R)-4-methoxypyrrolidin-2-yl]methanol;hydrochloride (CAS 1610033-20-9) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: [(2R,4R)-4-methoxypyrrolidin-2-yl]methanol;hydrochloride. InChIKey: JZJNYGFWGCTQFQ-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | [(2R,4R)-4-methoxypyrrolidin-2-yl]methanol;hydrochloride |
| InChIKey | JZJNYGFWGCTQFQ-KGZKBUQUSA-N |
| SMILES | CO[C@@H]1C[C@@H](NC1)CO.Cl |
Computed by PubChem (NCBI)