CAS 1315592-39-2 appears in our catalog under these names: (R)-N,N-Dimethyl-3-pyrrolidinecarboxamide hydrochloride, 95%, 95%, (R)-N,N-Dimethyl-3-pyrrolidinecarboxamide hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3R)-N,N-dimethylpyrrolidine-3-carboxamide;hydrochloride (CAS 1315592-39-2) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: (3R)-N,N-dimethylpyrrolidine-3-carboxamide;hydrochloride. InChIKey: DSOXCJZZKVNNJB-FYZOBXCZSA-N.
| Molecular formula | C7H15ClN2O |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | (3R)-N,N-dimethylpyrrolidine-3-carboxamide;hydrochloride |
| InChIKey | DSOXCJZZKVNNJB-FYZOBXCZSA-N |
| SMILES | CN(C)C(=O)[C@@H]1CCNC1.Cl |
Computed by PubChem (NCBI)