Products 131598-61-3

CAS 131598-61-3 is the registry number for 6-Amino-5-bromo-1-ethylpyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

6-amino-5-bromo-1-ethylpyrimidine-2,4-dione (CAS 131598-61-3) is a chemical compound with the molecular formula C6H8BrN3O2 and a molecular weight of 234.05 g/mol. IUPAC name: 6-amino-5-bromo-1-ethylpyrimidine-2,4-dione. InChIKey: DVZWWTRLSAYQKE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BrN3O2
Molecular weight234.05 g/mol
IUPAC name6-amino-5-bromo-1-ethylpyrimidine-2,4-dione
InChIKeyDVZWWTRLSAYQKE-UHFFFAOYSA-N
SMILESCCN1C(=C(C(=O)NC1=O)Br)N

Computed by PubChem (NCBI)