Products 1798723-23-5

CAS 1798723-23-5 is the registry number for 4-(5-Bromo-1H-1,2,4-triazol-1-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(5-bromo-1,2,4-triazol-1-yl)butanoic acid (CAS 1798723-23-5) is a chemical compound with the molecular formula C6H8BrN3O2 and a molecular weight of 234.05 g/mol. IUPAC name: 4-(5-bromo-1,2,4-triazol-1-yl)butanoic acid. InChIKey: QQKABLFZOWFBTH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BrN3O2
Molecular weight234.05 g/mol
IUPAC name4-(5-bromo-1,2,4-triazol-1-yl)butanoic acid
InChIKeyQQKABLFZOWFBTH-UHFFFAOYSA-N
SMILESC1=NN(C(=N1)Br)CCCC(=O)O

Computed by PubChem (NCBI)