CAS 1316753-66-8 is the registry number for Alpha,4-Dihydroxy-3-methoxy-Alpha-methyl-benzeneethanesulfonic Acid Potassium Salt. Offered by: TRC. Available pack sizes: 100mg, 1g.
Potassium 2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-2-sulfonate (CAS 1316753-66-8) is a chemical compound with the molecular formula C10H13KO6S and a molecular weight of 300.37 g/mol. IUPAC name: potassium 2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-2-sulfonate. InChIKey: UHFQRRDSERATAD-UHFFFAOYSA-M.
| Molecular formula | C10H13KO6S |
|---|---|
| Molecular weight | 300.37 g/mol |
| IUPAC name | potassium 2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-2-sulfonate |
| InChIKey | UHFQRRDSERATAD-UHFFFAOYSA-M |
| SMILES | CC(CC1=CC(=C(C=C1)O)OC)(O)S(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)