CAS 1794789-29-9 is the registry number for Alpha,4-Dihydroxy-3-methoxy-Alpha-methyl-benzeneethanesulfonic Acid Potassium Salt-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Potassium 2-methoxy-4-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-sulfopropyl)phenolate (CAS 1794789-29-9) is a chemical compound with the molecular formula C10H13KO6S and a molecular weight of 305.40 g/mol. IUPAC name: potassium 2-methoxy-4-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-sulfopropyl)phenolate. InChIKey: UHFQRRDSERATAD-LFMIHFMMSA-M.
| Molecular formula | C10H13KO6S |
|---|---|
| Molecular weight | 305.40 g/mol |
| IUPAC name | potassium 2-methoxy-4-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-sulfopropyl)phenolate |
| InChIKey | UHFQRRDSERATAD-LFMIHFMMSA-M |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])C1=CC(=C(C=C1)[O-])OC)(O)S(=O)(=O)O.[K+] |
Computed by PubChem (NCBI)