CAS 131685-10-4 appears in our catalog under these names: N-Acetyl-d3-S-(N-methylcarbamoyl)-L-cysteine, >95% (HPLC), N–Acetyl–d3–S–(N–methylcarbamoyl)–L–cysteine, N-Acetyl-S-(N-methylcarbamoyl)-L-cysteine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
(2R)-3-(methylcarbamoylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 131685-10-4) is a chemical compound with the molecular formula C7H12N2O4S and a molecular weight of 223.27 g/mol. IUPAC name: (2R)-3-(methylcarbamoylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: MXRPNYMMDLFYDL-MQBGRFPLSA-N.
| Molecular formula | C7H12N2O4S |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (2R)-3-(methylcarbamoylsulfanyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | MXRPNYMMDLFYDL-MQBGRFPLSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSC(=O)NC)C(=O)O |
Computed by PubChem (NCBI)