Products 152971-80-7

CAS 152971-80-7 is the registry number for Snap, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid (CAS 152971-80-7) is a chemical compound with the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. IUPAC name: 2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid. InChIKey: ZIIQCSMRQKCOCT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12N2O4S
Molecular weight220.25 g/mol
IUPAC name2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid
InChIKeyZIIQCSMRQKCOCT-UHFFFAOYSA-N
SMILESCC(=O)NC(C(=O)O)C(C)(C)SN=O

Computed by PubChem (NCBI)