CAS 152971-80-7 is the registry number for Snap, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid (CAS 152971-80-7) is a chemical compound with the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. IUPAC name: 2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid. InChIKey: ZIIQCSMRQKCOCT-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O4S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid |
| InChIKey | ZIIQCSMRQKCOCT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)O)C(C)(C)SN=O |
Computed by PubChem (NCBI)