CAS 13171-93-2 appears in our catalog under these names: Z-Gly-Gly-Phe-OH, 98%, Z–Gly–Gly–Phe–OH, Z-Gly-Gly-Phe-OH, Cbz-Gly-Gly-Phe-OH 98%, N-(Benzyloxycarbonyl)glycylglycyl-L-phenylalanine, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 25g, 5g, 10g, 50g, 250g, 100g.
(2S)-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid (CAS 13171-93-2) is a chemical compound with the molecular formula C21H23N3O6 and a molecular weight of 413.4 g/mol. IUPAC name: (2S)-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid. InChIKey: PARPWSYTROKYNG-KRWDZBQOSA-N.
| Molecular formula | C21H23N3O6 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid |
| InChIKey | PARPWSYTROKYNG-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)